C21H28N4O7S — CID 16521313
[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 3-(diethylsulfamoyl)benzoate (PubChem CID 16521313) has the molecular formula C21H28N4O7S and a molecular weight of 480.54 g/mol. Its IUPAC name is [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 3-(diethylsulfamoyl)benzoate.
| Compound Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 16521313 |
| Molecular Formula | C21H28N4O7S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)OCC(=O)NN2C(=O)NC3(CCCCC3)C2=O)c1 |
| InChI | InChI=1S/C21H28N4O7S/c1-3-24(4-2)33(30,31)16-10-8-9-15(13-16)18(27)32-14-17(26)23-25-19(28)21(22-20(25)29)11-6-5-7-12-21/h8-10,13H,3-7,11-12,14H2,1-2H3,(H,22,29)(H,23,26) |
| InChIKey | CFKIRKJIWSXYLJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|