C20H30N2O5S — CID 2505771
[2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 3-(diethylsulfamoyl)benzoate (PubChem CID 2505771) has the molecular formula C20H30N2O5S and a molecular weight of 410.54 g/mol. Its IUPAC name is [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 3-(diethylsulfamoyl)benzoate.
| Compound Name | [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2505771 |
| Molecular Formula | C20H30N2O5S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)OCC(=O)N[C@@H]2CCCC[C@H]2C)c1 |
| InChI | InChI=1S/C20H30N2O5S/c1-4-22(5-2)28(25,26)17-11-8-10-16(13-17)20(24)27-14-19(23)21-18-12-7-6-9-15(18)3/h8,10-11,13,15,18H,4-7,9,12,14H2,1-3H3,(H,21,23)/t15-,18-/m1/s1 |
| InChIKey | MBTGDEVVURHNLK-CRAIPNDOSA-N |
| XLogP | 2.57 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |