C24H30N2O5S — CID 6600800
[2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate (PubChem CID 6600800) has the molecular formula C24H30N2O5S and a molecular weight of 458.58 g/mol. Its IUPAC name is [2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 6600800 |
| Molecular Formula | C24H30N2O5S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | [2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-[ethyl(phenyl)sulfamoyl]benzoate |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)OCC(=O)N[C@H]2CCCC[C@@H]2C)cc1 |
| InChI | InChI=1S/C24H30N2O5S/c1-3-26(20-10-5-4-6-11-20)32(29,30)21-15-13-19(14-16-21)24(28)31-17-23(27)25-22-12-8-7-9-18(22)2/h4-6,10-11,13-16,18,22H,3,7-9,12,17H2,1-2H3,(H,25,27)/t18-,22-/m0/s1 |
| InChIKey | KPCAWJOYLBJHEJ-AVRDEDQJSA-N |
| XLogP | 3.75 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |