C18H26N2O5S — CID 11917240
[2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-(ethylsulfamoyl)benzoate (PubChem CID 11917240) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-(ethylsulfamoyl)benzoate.
| Compound Name | [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-(ethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 11917240 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-(ethylsulfamoyl)benzoate |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)OCC(=O)N[C@H]2CCCC[C@H]2C)cc1 |
| InChI | InChI=1S/C18H26N2O5S/c1-3-19-26(23,24)15-10-8-14(9-11-15)18(22)25-12-17(21)20-16-7-5-4-6-13(16)2/h8-11,13,16,19H,3-7,12H2,1-2H3,(H,20,21)/t13-,16+/m1/s1 |
| InChIKey | SUJZNDKBGAITKZ-CJNGLKHVSA-N |
| XLogP | 1.84 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |