C18H25NO4 — CID 2441435
[2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-ethoxybenzoate (PubChem CID 2441435) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is [2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-ethoxybenzoate.
| Compound Name | [2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 2441435 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | [2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)N[C@@H]2CCCC[C@@H]2C)cc1 |
| InChI | InChI=1S/C18H25NO4/c1-3-22-15-10-8-14(9-11-15)18(21)23-12-17(20)19-16-7-5-4-6-13(16)2/h8-11,13,16H,3-7,12H2,1-2H3,(H,19,20)/t13-,16+/m0/s1 |
| InChIKey | JUQXNRIBSPAGKJ-XJKSGUPXSA-N |
| XLogP | 2.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |