C24H27NO5 — CID 7373637
[2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-(4-acetyloxyphenyl)benzoate (PubChem CID 7373637) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-(4-acetyloxyphenyl)benzoate.
| Compound Name | [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-(4-acetyloxyphenyl)benzoate |
|---|---|
| PubChem CID | 7373637 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | [2-[[(1R,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-(4-acetyloxyphenyl)benzoate |
| SMILES | CC(=O)Oc1ccc(-c2ccc(C(=O)OCC(=O)N[C@@H]3CCCC[C@H]3C)cc2)cc1 |
| InChI | InChI=1S/C24H27NO5/c1-16-5-3-4-6-22(16)25-23(27)15-29-24(28)20-9-7-18(8-10-20)19-11-13-21(14-12-19)30-17(2)26/h7-14,16,22H,3-6,15H2,1-2H3,(H,25,27)/t16-,22-/m1/s1 |
| InChIKey | XEWMBYBBKDBDNP-OPAMFIHVSA-N |
| XLogP | 4.13 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|