C16H20FNO3 — CID 2627211
[2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-fluorobenzoate (PubChem CID 2627211) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-fluorobenzoate.
| Compound Name | [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 2627211 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] 4-fluorobenzoate |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)COC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H20FNO3/c1-11-4-2-3-5-14(11)18-15(19)10-21-16(20)12-6-8-13(17)9-7-12/h6-9,11,14H,2-5,10H2,1H3,(H,18,19)/t11-,14+/m1/s1 |
| InChIKey | LLQJEIHVDGDIIW-RISCZKNCSA-N |
| XLogP | 2.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |