C19H27N5O6S — CID 27532874
2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 27532874) has the molecular formula C19H27N5O6S and a molecular weight of 453.52 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 27532874 |
| Molecular Formula | C19H27N5O6S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(=O)n(CC(=O)NN2C(=O)NC3(CCCCC3)C2=O)c1 |
| InChI | InChI=1S/C19H27N5O6S/c1-3-23(4-2)31(29,30)14-8-9-16(26)22(12-14)13-15(25)21-24-17(27)19(20-18(24)28)10-6-5-7-11-19/h8-9,12H,3-7,10-11,13H2,1-2H3,(H,20,28)(H,21,25) |
| InChIKey | URGGWBKNKJIXAD-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 137.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|