C18H30N4O5S — CID 47035955
2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(1-morpholin-4-ylpropan-2-yl)acetamide (PubChem CID 47035955) has the molecular formula C18H30N4O5S and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(1-morpholin-4-ylpropan-2-yl)acetamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(1-morpholin-4-ylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 47035955 |
| Molecular Formula | C18H30N4O5S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(1-morpholin-4-ylpropan-2-yl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(=O)n(CC(=O)NC(C)CN2CCOCC2)c1 |
| InChI | InChI=1S/C18H30N4O5S/c1-4-22(5-2)28(25,26)16-6-7-18(24)21(13-16)14-17(23)19-15(3)12-20-8-10-27-11-9-20/h6-7,13,15H,4-5,8-12,14H2,1-3H3,(H,19,23) |
| InChIKey | JBKJPRCFJKKYEE-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |