C20H34N4O4S — CID 47060853
N-(1-tert-butylpiperidin-4-yl)-2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]acetamide (PubChem CID 47060853) has the molecular formula C20H34N4O4S and a molecular weight of 426.58 g/mol. Its IUPAC name is N-(1-tert-butylpiperidin-4-yl)-2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]acetamide.
| Compound Name | N-(1-tert-butylpiperidin-4-yl)-2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 47060853 |
| Molecular Formula | C20H34N4O4S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-(1-tert-butylpiperidin-4-yl)-2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(=O)n(CC(=O)NC2CCN(C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C20H34N4O4S/c1-6-24(7-2)29(27,28)17-8-9-19(26)22(14-17)15-18(25)21-16-10-12-23(13-11-16)20(3,4)5/h8-9,14,16H,6-7,10-13,15H2,1-5H3,(H,21,25) |
| InChIKey | WRMFBWMTZJMKSH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |