C14H21N3O4S — CID 9399528
2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-prop-2-enylacetamide (PubChem CID 9399528) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-prop-2-enylacetamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 9399528 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)Cn1cc(S(=O)(=O)N(CC)CC)ccc1=O |
| InChI | InChI=1S/C14H21N3O4S/c1-4-9-15-13(18)11-16-10-12(7-8-14(16)19)22(20,21)17(5-2)6-3/h4,7-8,10H,1,5-6,9,11H2,2-3H3,(H,15,18) |
| InChIKey | NJKSWESXUZGULZ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|