C19H24FN3O5S — CID 37362916
2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[2-(4-fluorophenoxy)ethyl]acetamide (PubChem CID 37362916) has the molecular formula C19H24FN3O5S and a molecular weight of 425.48 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[2-(4-fluorophenoxy)ethyl]acetamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[2-(4-fluorophenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 37362916 |
| Molecular Formula | C19H24FN3O5S |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[2-(4-fluorophenoxy)ethyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(=O)n(CC(=O)NCCOc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H24FN3O5S/c1-3-23(4-2)29(26,27)17-9-10-19(25)22(13-17)14-18(24)21-11-12-28-16-7-5-15(20)6-8-16/h5-10,13H,3-4,11-12,14H2,1-2H3,(H,21,24) |
| InChIKey | CXXGOTHLMJOANY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|