C17H20FN3O4S — CID 7252285
2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(3-fluorophenyl)acetamide (PubChem CID 7252285) has the molecular formula C17H20FN3O4S and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 7252285 |
| Molecular Formula | C17H20FN3O4S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(3-fluorophenyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(=O)n(CC(=O)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C17H20FN3O4S/c1-3-21(4-2)26(24,25)15-8-9-17(23)20(11-15)12-16(22)19-14-7-5-6-13(18)10-14/h5-11H,3-4,12H2,1-2H3,(H,19,22) |
| InChIKey | PWTKQVVSAJAVDX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |