C17H19F2N3O4S — CID 7252313
2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2,4-difluorophenyl)acetamide (PubChem CID 7252313) has the molecular formula C17H19F2N3O4S and a molecular weight of 399.42 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2,4-difluorophenyl)acetamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 7252313 |
| Molecular Formula | C17H19F2N3O4S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2,4-difluorophenyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(=O)n(CC(=O)Nc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C17H19F2N3O4S/c1-3-22(4-2)27(25,26)13-6-8-17(24)21(10-13)11-16(23)20-15-7-5-12(18)9-14(15)19/h5-10H,3-4,11H2,1-2H3,(H,20,23) |
| InChIKey | YPZARMZQMKNFMU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |