C17H18Cl3N3O4S — CID 41114327
2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 41114327) has the molecular formula C17H18Cl3N3O4S and a molecular weight of 466.77 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 41114327 |
| Molecular Formula | C17H18Cl3N3O4S |
| Molecular Weight | 466.77 g/mol |
| Exact Mass | 465.01 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(=O)n(CC(=O)Nc2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H18Cl3N3O4S/c1-3-23(4-2)28(26,27)11-5-6-17(25)22(9-11)10-16(24)21-15-8-13(19)12(18)7-14(15)20/h5-9H,3-4,10H2,1-2H3,(H,21,24) |
| InChIKey | IXTWDIYRGNUCIE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.77 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|