C21H29N3O4S — CID 7768257
N-[4-[(2S)-butan-2-yl]phenyl]-2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]acetamide (PubChem CID 7768257) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-[4-[(2S)-butan-2-yl]phenyl]-2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]acetamide.
| Compound Name | N-[4-[(2S)-butan-2-yl]phenyl]-2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 7768257 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-[4-[(2S)-butan-2-yl]phenyl]-2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]acetamide |
| SMILES | CC[C@H](C)c1ccc(NC(=O)Cn2cc(S(=O)(=O)N(CC)CC)ccc2=O)cc1 |
| InChI | InChI=1S/C21H29N3O4S/c1-5-16(4)17-8-10-18(11-9-17)22-20(25)15-23-14-19(12-13-21(23)26)29(27,28)24(6-2)7-3/h8-14,16H,5-7,15H2,1-4H3,(H,22,25)/t16-/m0/s1 |
| InChIKey | ZYGVFUHTDMABAS-INIZCTEOSA-N |
| XLogP | 3.03 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |