C19H23N3O6S — CID 24609497
methyl 1-[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl]-6-oxopyridine-3-carboxylate (PubChem CID 24609497) has the molecular formula C19H23N3O6S and a molecular weight of 421.48 g/mol. Its IUPAC name is methyl 1-[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl]-6-oxopyridine-3-carboxylate.
| Compound Name | methyl 1-[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl]-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 24609497 |
| Molecular Formula | C19H23N3O6S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | methyl 1-[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl]-6-oxopyridine-3-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)Cn2cc(C(=O)OC)ccc2=O)cc1 |
| InChI | InChI=1S/C19H23N3O6S/c1-4-22(5-2)29(26,27)16-9-7-15(8-10-16)20-17(23)13-21-12-14(19(25)28-3)6-11-18(21)24/h6-12H,4-5,13H2,1-3H3,(H,20,23) |
| InChIKey | BPLHNOIEDYCCDW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |