C22H29N3O6S — CID 43056029
2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[3-(oxolan-2-ylmethoxy)phenyl]acetamide (PubChem CID 43056029) has the molecular formula C22H29N3O6S and a molecular weight of 463.56 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[3-(oxolan-2-ylmethoxy)phenyl]acetamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[3-(oxolan-2-ylmethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 43056029 |
| Molecular Formula | C22H29N3O6S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[3-(oxolan-2-ylmethoxy)phenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(=O)n(CC(=O)Nc2cccc(OCC3CCCO3)c2)c1 |
| InChI | InChI=1S/C22H29N3O6S/c1-3-25(4-2)32(28,29)20-10-11-22(27)24(14-20)15-21(26)23-17-7-5-8-18(13-17)31-16-19-9-6-12-30-19/h5,7-8,10-11,13-14,19H,3-4,6,9,12,15-16H2,1-2H3,(H,23,26) |
| InChIKey | RURCWADEAIYBJL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |