C21H28FN3O5S — CID 30857026
2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[4-(4-fluorophenoxy)butyl]acetamide (PubChem CID 30857026) has the molecular formula C21H28FN3O5S and a molecular weight of 453.54 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[4-(4-fluorophenoxy)butyl]acetamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[4-(4-fluorophenoxy)butyl]acetamide |
|---|---|
| PubChem CID | 30857026 |
| Molecular Formula | C21H28FN3O5S |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[4-(4-fluorophenoxy)butyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(=O)n(CC(=O)NCCCCOc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H28FN3O5S/c1-3-25(4-2)31(28,29)19-11-12-21(27)24(15-19)16-20(26)23-13-5-6-14-30-18-9-7-17(22)8-10-18/h7-12,15H,3-6,13-14,16H2,1-2H3,(H,23,26) |
| InChIKey | UYEKAKIXCGDNLI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|