C17H29N3O4S — CID 55400476
2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N,N-dipropylacetamide (PubChem CID 55400476) has the molecular formula C17H29N3O4S and a molecular weight of 371.50 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N,N-dipropylacetamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 55400476 |
| Molecular Formula | C17H29N3O4S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)Cn1cc(S(=O)(=O)N(CC)CC)ccc1=O |
| InChI | InChI=1S/C17H29N3O4S/c1-5-11-18(12-6-2)17(22)14-19-13-15(9-10-16(19)21)25(23,24)20(7-3)8-4/h9-10,13H,5-8,11-12,14H2,1-4H3 |
| InChIKey | FKGBUTUWQNOPIY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |