C19H22N2O6S — CID 7977627
phenacyl 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]acetate (PubChem CID 7977627) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is phenacyl 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]acetate.
| Compound Name | phenacyl 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]acetate |
|---|---|
| PubChem CID | 7977627 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | phenacyl 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]acetate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(=O)n(CC(=O)OCC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C19H22N2O6S/c1-3-21(4-2)28(25,26)16-10-11-18(23)20(12-16)13-19(24)27-14-17(22)15-8-6-5-7-9-15/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | UJFIIOQNUYCUCC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |