C23H32N4O4S — CID 43005232
2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2-phenyl-2-pyrrolidin-1-ylethyl)acetamide (PubChem CID 43005232) has the molecular formula C23H32N4O4S and a molecular weight of 460.60 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2-phenyl-2-pyrrolidin-1-ylethyl)acetamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2-phenyl-2-pyrrolidin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 43005232 |
| Molecular Formula | C23H32N4O4S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2-phenyl-2-pyrrolidin-1-ylethyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(=O)n(CC(=O)NCC(c2ccccc2)N2CCCC2)c1 |
| InChI | InChI=1S/C23H32N4O4S/c1-3-27(4-2)32(30,31)20-12-13-23(29)26(17-20)18-22(28)24-16-21(25-14-8-9-15-25)19-10-6-5-7-11-19/h5-7,10-13,17,21H,3-4,8-9,14-16,18H2,1-2H3,(H,24,28) |
| InChIKey | DQXCTIRLAFYABO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |