C19H32N4O4S — CID 30765589
2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(1-propan-2-ylpiperidin-4-yl)acetamide (PubChem CID 30765589) has the molecular formula C19H32N4O4S and a molecular weight of 412.56 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(1-propan-2-ylpiperidin-4-yl)acetamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(1-propan-2-ylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 30765589 |
| Molecular Formula | C19H32N4O4S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(1-propan-2-ylpiperidin-4-yl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(=O)n(CC(=O)NC2CCN(C(C)C)CC2)c1 |
| InChI | InChI=1S/C19H32N4O4S/c1-5-23(6-2)28(26,27)17-7-8-19(25)22(13-17)14-18(24)20-16-9-11-21(12-10-16)15(3)4/h7-8,13,15-16H,5-6,9-12,14H2,1-4H3,(H,20,24) |
| InChIKey | USHQYLYHQGABSD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |