C18H29N3O6S — CID 71858593
2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[1-(oxolan-3-yloxy)propan-2-yl]acetamide (PubChem CID 71858593) has the molecular formula C18H29N3O6S and a molecular weight of 415.51 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[1-(oxolan-3-yloxy)propan-2-yl]acetamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[1-(oxolan-3-yloxy)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 71858593 |
| Molecular Formula | C18H29N3O6S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[1-(oxolan-3-yloxy)propan-2-yl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(=O)n(CC(=O)NC(C)COC2CCOC2)c1 |
| InChI | InChI=1S/C18H29N3O6S/c1-4-21(5-2)28(24,25)16-6-7-18(23)20(10-16)11-17(22)19-14(3)12-27-15-8-9-26-13-15/h6-7,10,14-15H,4-5,8-9,11-13H2,1-3H3,(H,19,22) |
| InChIKey | GCAOXJNHUUYURU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |