C22H25N3O5S — CID 55384576
2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[furan-2-yl(phenyl)methyl]acetamide (PubChem CID 55384576) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[furan-2-yl(phenyl)methyl]acetamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[furan-2-yl(phenyl)methyl]acetamide |
|---|---|
| PubChem CID | 55384576 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[furan-2-yl(phenyl)methyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(=O)n(CC(=O)NC(c2ccccc2)c2ccco2)c1 |
| InChI | InChI=1S/C22H25N3O5S/c1-3-25(4-2)31(28,29)18-12-13-21(27)24(15-18)16-20(26)23-22(19-11-8-14-30-19)17-9-6-5-7-10-17/h5-15,22H,3-4,16H2,1-2H3,(H,23,26) |
| InChIKey | IWPTZNBDFDCAPP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |