C20H24N4O6 — CID 8523744
[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-[(2-phenylacetyl)amino]acetate (PubChem CID 8523744) has the molecular formula C20H24N4O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-[(2-phenylacetyl)amino]acetate.
| Compound Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-[(2-phenylacetyl)amino]acetate |
|---|---|
| PubChem CID | 8523744 |
| Molecular Formula | C20H24N4O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-[(2-phenylacetyl)amino]acetate |
| SMILES | O=C(Cc1ccccc1)NCC(=O)OCC(=O)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C20H24N4O6/c25-15(11-14-7-3-1-4-8-14)21-12-17(27)30-13-16(26)23-24-18(28)20(22-19(24)29)9-5-2-6-10-20/h1,3-4,7-8H,2,5-6,9-13H2,(H,21,25)(H,22,29)(H,23,26) |
| InChIKey | SNXRVHCEPNWMKA-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|