C22H22N4O7 — CID 16533736
[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)benzoate (PubChem CID 16533736) has the molecular formula C22H22N4O7 and a molecular weight of 454.44 g/mol. Its IUPAC name is [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)benzoate.
| Compound Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 16533736 |
| Molecular Formula | C22H22N4O7 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | [2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1NC(=O)c1ccco1)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C22H22N4O7/c27-17(25-26-20(30)22(24-21(26)31)10-4-1-5-11-22)13-33-19(29)14-7-2-3-8-15(14)23-18(28)16-9-6-12-32-16/h2-3,6-9,12H,1,4-5,10-11,13H2,(H,23,28)(H,24,31)(H,25,27) |
| InChIKey | CINASOHGMBDBLX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 147.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|