C20H16N2O5 — CID 2392128
(2-anilino-2-oxoethyl) 2-(furan-2-carbonylamino)benzoate (PubChem CID 2392128) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 2-(furan-2-carbonylamino)benzoate.
| Compound Name | (2-anilino-2-oxoethyl) 2-(furan-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 2392128 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (2-anilino-2-oxoethyl) 2-(furan-2-carbonylamino)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1NC(=O)c1ccco1)Nc1ccccc1 |
| InChI | InChI=1S/C20H16N2O5/c23-18(21-14-7-2-1-3-8-14)13-27-20(25)15-9-4-5-10-16(15)22-19(24)17-11-6-12-26-17/h1-12H,13H2,(H,21,23)(H,22,24) |
| InChIKey | ONWNSKFWCNZVCO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |