C22H18N2O7 — CID 18776833
[2-(4-methoxycarbonylanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)benzoate (PubChem CID 18776833) has the molecular formula C22H18N2O7 and a molecular weight of 422.39 g/mol. Its IUPAC name is [2-(4-methoxycarbonylanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)benzoate.
| Compound Name | [2-(4-methoxycarbonylanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 18776833 |
| Molecular Formula | C22H18N2O7 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | [2-(4-methoxycarbonylanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)COC(=O)c2ccccc2NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C22H18N2O7/c1-29-21(27)14-8-10-15(11-9-14)23-19(25)13-31-22(28)16-5-2-3-6-17(16)24-20(26)18-7-4-12-30-18/h2-12H,13H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | XNMVSGPUBNDKGL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |