C20H19N3O5 — CID 9139731
[2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-(furan-2-carbonylamino)benzoate (PubChem CID 9139731) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-(furan-2-carbonylamino)benzoate.
| Compound Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-(furan-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 9139731 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-(furan-2-carbonylamino)benzoate |
| SMILES | C[C@](C#N)(NC(=O)COC(=O)c1ccccc1NC(=O)c1ccco1)C1CC1 |
| InChI | InChI=1S/C20H19N3O5/c1-20(12-21,13-8-9-13)23-17(24)11-28-19(26)14-5-2-3-6-15(14)22-18(25)16-7-4-10-27-16/h2-7,10,13H,8-9,11H2,1H3,(H,22,25)(H,23,24)/t20-/m1/s1 |
| InChIKey | HGGXTAMDCXBKIR-HXUWFJFHSA-N |
| XLogP | 2.50 |
| TPSA | 121.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |