C16H18N2O4 — CID 7811616
[2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-methoxybenzoate (PubChem CID 7811616) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-methoxybenzoate.
| Compound Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 7811616 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)OCC(=O)N[C@](C)(C#N)C1CC1 |
| InChI | InChI=1S/C16H18N2O4/c1-16(10-17,11-7-8-11)18-14(19)9-22-15(20)12-5-3-4-6-13(12)21-2/h3-6,11H,7-9H2,1-2H3,(H,18,19)/t16-/m1/s1 |
| InChIKey | PUURPXMCOIKRJW-MRXNPFEDSA-N |
| XLogP | 1.66 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |