C21H21N3O3 — CID 7781800
[2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-anilinobenzoate (PubChem CID 7781800) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-anilinobenzoate.
| Compound Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-anilinobenzoate |
|---|---|
| PubChem CID | 7781800 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-anilinobenzoate |
| SMILES | C[C@](C#N)(NC(=O)COC(=O)c1ccccc1Nc1ccccc1)C1CC1 |
| InChI | InChI=1S/C21H21N3O3/c1-21(14-22,15-11-12-15)24-19(25)13-27-20(26)17-9-5-6-10-18(17)23-16-7-3-2-4-8-16/h2-10,15,23H,11-13H2,1H3,(H,24,25)/t21-/m1/s1 |
| InChIKey | SUVAGZKILGHRCT-OAQYLSRUSA-N |
| XLogP | 3.40 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |