C17H20N2O3 — CID 7654646
[2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 3-phenylpropanoate (PubChem CID 7654646) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 3-phenylpropanoate.
| Compound Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 7654646 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 3-phenylpropanoate |
| SMILES | C[C@](C#N)(NC(=O)COC(=O)CCc1ccccc1)C1CC1 |
| InChI | InChI=1S/C17H20N2O3/c1-17(12-18,14-8-9-14)19-15(20)11-22-16(21)10-7-13-5-3-2-4-6-13/h2-6,14H,7-11H2,1H3,(H,19,20)/t17-/m1/s1 |
| InChIKey | WBUHSYNGKGDNST-QGZVFWFLSA-N |
| XLogP | 1.97 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |