C22H22N2O4 — CID 9140600
[2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-(4-phenylphenoxy)acetate (PubChem CID 9140600) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is [2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-(4-phenylphenoxy)acetate.
| Compound Name | [2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-(4-phenylphenoxy)acetate |
|---|---|
| PubChem CID | 9140600 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] 2-(4-phenylphenoxy)acetate |
| SMILES | C[C@@](C#N)(NC(=O)COC(=O)COc1ccc(-c2ccccc2)cc1)C1CC1 |
| InChI | InChI=1S/C22H22N2O4/c1-22(15-23,18-9-10-18)24-20(25)13-28-21(26)14-27-19-11-7-17(8-12-19)16-5-3-2-4-6-16/h2-8,11-12,18H,9-10,13-14H2,1H3,(H,24,25)/t22-/m0/s1 |
| InChIKey | UFLGMBSFAMLTPP-QFIPXVFZSA-N |
| XLogP | 3.08 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |