C18H19N3O4 — CID 7983949
[2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] (2S)-2-(4-cyanophenoxy)propanoate (PubChem CID 7983949) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] (2S)-2-(4-cyanophenoxy)propanoate.
| Compound Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] (2S)-2-(4-cyanophenoxy)propanoate |
|---|---|
| PubChem CID | 7983949 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] (2S)-2-(4-cyanophenoxy)propanoate |
| SMILES | C[C@H](Oc1ccc(C#N)cc1)C(=O)OCC(=O)N[C@](C)(C#N)C1CC1 |
| InChI | InChI=1S/C18H19N3O4/c1-12(25-15-7-3-13(9-19)4-8-15)17(23)24-10-16(22)21-18(2,11-20)14-5-6-14/h3-4,7-8,12,14H,5-6,10H2,1-2H3,(H,21,22)/t12-,18+/m0/s1 |
| InChIKey | AKOHBISEYSKSPR-KPZWWZAWSA-N |
| XLogP | 1.68 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |