C16H19NO4 — CID 7984032
(3,3-dimethyl-2-oxobutyl) (2S)-2-(4-cyanophenoxy)propanoate (PubChem CID 7984032) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) (2S)-2-(4-cyanophenoxy)propanoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) (2S)-2-(4-cyanophenoxy)propanoate |
|---|---|
| PubChem CID | 7984032 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) (2S)-2-(4-cyanophenoxy)propanoate |
| SMILES | C[C@H](Oc1ccc(C#N)cc1)C(=O)OCC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H19NO4/c1-11(15(19)20-10-14(18)16(2,3)4)21-13-7-5-12(9-17)6-8-13/h5-8,11H,10H2,1-4H3/t11-/m0/s1 |
| InChIKey | MRZVUZUVSZHDRY-NSHDSACASA-N |
| XLogP | 2.48 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |