C18H21N3O4 — CID 7983637
[2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] (2S)-2-(4-cyanophenoxy)propanoate (PubChem CID 7983637) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] (2S)-2-(4-cyanophenoxy)propanoate.
| Compound Name | [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] (2S)-2-(4-cyanophenoxy)propanoate |
|---|---|
| PubChem CID | 7983637 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] (2S)-2-(4-cyanophenoxy)propanoate |
| SMILES | CC(C)[C@@](C)(C#N)NC(=O)COC(=O)[C@H](C)Oc1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H21N3O4/c1-12(2)18(4,11-20)21-16(22)10-24-17(23)13(3)25-15-7-5-14(9-19)6-8-15/h5-8,12-13H,10H2,1-4H3,(H,21,22)/t13-,18+/m0/s1 |
| InChIKey | MSCKBCQLGJZRQL-SCLBCKFNSA-N |
| XLogP | 1.92 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |