C17H21BrN2O4 — CID 7743048
[2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] (2S)-2-(4-bromophenoxy)propanoate (PubChem CID 7743048) has the molecular formula C17H21BrN2O4 and a molecular weight of 397.27 g/mol. Its IUPAC name is [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] (2S)-2-(4-bromophenoxy)propanoate.
| Compound Name | [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] (2S)-2-(4-bromophenoxy)propanoate |
|---|---|
| PubChem CID | 7743048 |
| Molecular Formula | C17H21BrN2O4 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] (2S)-2-(4-bromophenoxy)propanoate |
| SMILES | CC(C)[C@](C)(C#N)NC(=O)COC(=O)[C@H](C)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H21BrN2O4/c1-11(2)17(4,10-19)20-15(21)9-23-16(22)12(3)24-14-7-5-13(18)6-8-14/h5-8,11-12H,9H2,1-4H3,(H,20,21)/t12-,17-/m0/s1 |
| InChIKey | SZKBSAGVWJSSKD-SJCJKPOMSA-N |
| XLogP | 2.81 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |