C17H19N3O4 — CID 9140979
[2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-(4-cyanophenoxy)acetate (PubChem CID 9140979) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-(4-cyanophenoxy)acetate.
| Compound Name | [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-(4-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 9140979 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-(4-cyanophenoxy)acetate |
| SMILES | CC(C)[C@@](C)(C#N)NC(=O)COC(=O)COc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H19N3O4/c1-12(2)17(3,11-19)20-15(21)9-24-16(22)10-23-14-6-4-13(8-18)5-7-14/h4-7,12H,9-10H2,1-3H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | CAFWKQAKCVDLKG-QGZVFWFLSA-N |
| XLogP | 1.53 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |