C18H24N2O3 — CID 7265853
[2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] (3R)-3-phenylbutanoate (PubChem CID 7265853) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] (3R)-3-phenylbutanoate.
| Compound Name | [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] (3R)-3-phenylbutanoate |
|---|---|
| PubChem CID | 7265853 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] (3R)-3-phenylbutanoate |
| SMILES | CC(C)[C@@](C)(C#N)NC(=O)COC(=O)C[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H24N2O3/c1-13(2)18(4,12-19)20-16(21)11-23-17(22)10-14(3)15-8-6-5-7-9-15/h5-9,13-14H,10-11H2,1-4H3,(H,20,21)/t14-,18-/m1/s1 |
| InChIKey | HXVWCIOYAJFKFX-RDTXWAMCSA-N |
| XLogP | 2.78 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |