C15H18N2O3 — CID 7265779
[2-(2-cyanoethylamino)-2-oxoethyl] (3R)-3-phenylbutanoate (PubChem CID 7265779) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is [2-(2-cyanoethylamino)-2-oxoethyl] (3R)-3-phenylbutanoate.
| Compound Name | [2-(2-cyanoethylamino)-2-oxoethyl] (3R)-3-phenylbutanoate |
|---|---|
| PubChem CID | 7265779 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | [2-(2-cyanoethylamino)-2-oxoethyl] (3R)-3-phenylbutanoate |
| SMILES | C[C@H](CC(=O)OCC(=O)NCCC#N)c1ccccc1 |
| InChI | InChI=1S/C15H18N2O3/c1-12(13-6-3-2-4-7-13)10-15(19)20-11-14(18)17-9-5-8-16/h2-4,6-7,12H,5,9-11H2,1H3,(H,17,18)/t12-/m1/s1 |
| InChIKey | MBSGWRKNGMXDPX-GFCCVEGCSA-N |
| XLogP | 1.75 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|