C17H22N4O4 — CID 7616820
[2-(2-cyanoethylamino)-2-oxoethyl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate (PubChem CID 7616820) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is [2-(2-cyanoethylamino)-2-oxoethyl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate.
| Compound Name | [2-(2-cyanoethylamino)-2-oxoethyl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate |
|---|---|
| PubChem CID | 7616820 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | [2-(2-cyanoethylamino)-2-oxoethyl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate |
| SMILES | CC(C)[C@@H](NC(=O)Nc1ccccc1)C(=O)OCC(=O)NCCC#N |
| InChI | InChI=1S/C17H22N4O4/c1-12(2)15(16(23)25-11-14(22)19-10-6-9-18)21-17(24)20-13-7-4-3-5-8-13/h3-5,7-8,12,15H,6,10-11H2,1-2H3,(H,19,22)(H2,20,21,24)/t15-/m1/s1 |
| InChIKey | UPAIZDOBGMFYNA-OAHLLOKOSA-N |
| XLogP | 1.41 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|