C18H26N4O5 — CID 7617061
[2-oxo-2-(propylcarbamoylamino)ethyl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate (PubChem CID 7617061) has the molecular formula C18H26N4O5 and a molecular weight of 378.43 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate |
|---|---|
| PubChem CID | 7617061 |
| Molecular Formula | C18H26N4O5 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)[C@@H](NC(=O)Nc1ccccc1)C(C)C |
| InChI | InChI=1S/C18H26N4O5/c1-4-10-19-17(25)21-14(23)11-27-16(24)15(12(2)3)22-18(26)20-13-8-6-5-7-9-13/h5-9,12,15H,4,10-11H2,1-3H3,(H2,20,22,26)(H2,19,21,23,25)/t15-/m0/s1 |
| InChIKey | SYHFPUFEJHOTDY-HNNXBMFYSA-N |
| XLogP | 1.61 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |