C24H31N3O4 — CID 9459247
[2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate (PubChem CID 9459247) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate.
| Compound Name | [2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate |
|---|---|
| PubChem CID | 9459247 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | [2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate |
| SMILES | CCC[C@@H](NC(=O)COC(=O)[C@H](NC(=O)Nc1ccccc1)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H31N3O4/c1-4-11-20(18-12-7-5-8-13-18)26-21(28)16-31-23(29)22(17(2)3)27-24(30)25-19-14-9-6-10-15-19/h5-10,12-15,17,20,22H,4,11,16H2,1-3H3,(H,26,28)(H2,25,27,30)/t20-,22-/m1/s1 |
| InChIKey | PAKLMJWKHWKROK-IFMALSPDSA-N |
| XLogP | 4.03 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |