C15H17FN2O3 — CID 2651017
[2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-fluorobenzoate (PubChem CID 2651017) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-fluorobenzoate.
| Compound Name | [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 2651017 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | [2-[[(2R)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-fluorobenzoate |
| SMILES | CC(C)[C@](C)(C#N)NC(=O)COC(=O)c1ccccc1F |
| InChI | InChI=1S/C15H17FN2O3/c1-10(2)15(3,9-17)18-13(19)8-21-14(20)11-6-4-5-7-12(11)16/h4-7,10H,8H2,1-3H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | KKDGNMYJQKCPDC-HNNXBMFYSA-N |
| XLogP | 2.04 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |