C23H24N2O4 — CID 6915517
[2-[(2-cyano-3-methylbutan-2-yl)amino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate (PubChem CID 6915517) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is [2-[(2-cyano-3-methylbutan-2-yl)amino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate.
| Compound Name | [2-[(2-cyano-3-methylbutan-2-yl)amino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate |
|---|---|
| PubChem CID | 6915517 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | [2-[(2-cyano-3-methylbutan-2-yl)amino]-2-oxoethyl] 2-(4-methylbenzoyl)benzoate |
| SMILES | Cc1ccc(C(=O)c2ccccc2C(=O)OCC(=O)NC(C)(C#N)C(C)C)cc1 |
| InChI | InChI=1S/C23H24N2O4/c1-15(2)23(4,14-24)25-20(26)13-29-22(28)19-8-6-5-7-18(19)21(27)17-11-9-16(3)10-12-17/h5-12,15H,13H2,1-4H3,(H,25,26) |
| InChIKey | MEFNEFDYFFMXQJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |