C24H23N3O3 — CID 7777394
[2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-phenylquinoline-4-carboxylate (PubChem CID 7777394) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-phenylquinoline-4-carboxylate.
| Compound Name | [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 7777394 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-phenylquinoline-4-carboxylate |
| SMILES | CC(C)[C@@](C)(C#N)NC(=O)COC(=O)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C24H23N3O3/c1-16(2)24(3,15-25)27-22(28)14-30-23(29)19-13-21(17-9-5-4-6-10-17)26-20-12-8-7-11-18(19)20/h4-13,16H,14H2,1-3H3,(H,27,28)/t24-/m1/s1 |
| InChIKey | VPEILDHAAPGDRD-XMMPIXPASA-N |
| XLogP | 4.11 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |