[(1R)-1-cyanoethyl] 2-phenylquinoline-4-carboxylate

C19H14N2O2 — CID 7782208

IUPAC[(1R)-1-cyanoethyl] 2-phenylquinoline-4-carboxylate
SMILESC[C@H](C#N)OC(=O)c1cc(-c2ccccc2)nc2ccccc12
InChIInChI=1S/C19H14N2O2/c1-13(12-20)23-19(22)16-11-18(14-7-3-2-4-8-14)21-17-10-6-5-9-15(16)17/h2-11,13H,1H3/t13-/m1/s1
InChIKeyWRXCPYDXJZBRHD-CYBMUJFWSA-N
MW302.33 g/mol
LogP3.97
Rot. Bonds3

About [(1R)-1-cyanoethyl] 2-phenylquinoline-4-carboxylate

[(1R)-1-cyanoethyl] 2-phenylquinoline-4-carboxylate (PubChem CID 7782208) has the molecular formula C19H14N2O2 and a molecular weight of 302.33 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 2-phenylquinoline-4-carboxylate.

Molecular Properties

Compound Name[(1R)-1-cyanoethyl] 2-phenylquinoline-4-carboxylate
PubChem CID7782208
Molecular FormulaC19H14N2O2
Molecular Weight302.33 g/mol
Exact Mass302.11
IUPAC Name[(1R)-1-cyanoethyl] 2-phenylquinoline-4-carboxylate
SMILESC[C@H](C#N)OC(=O)c1cc(-c2ccccc2)nc2ccccc12
InChIInChI=1S/C19H14N2O2/c1-13(12-20)23-19(22)16-11-18(14-7-3-2-4-8-14)21-17-10-6-5-9-15(16)17/h2-11,13H,1H3/t13-/m1/s1
InChIKeyWRXCPYDXJZBRHD-CYBMUJFWSA-N
XLogP3.97
TPSA62.98 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.33
LogP ≤ 53.97
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze [(1R)-1-cyanoethyl] 2-phenylquinoline-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(1R)-1-cyanoethyl] 2-phenylquinoline-4-carboxylate?
The IUPAC name of [(1R)-1-cyanoethyl] 2-phenylquinoline-4-carboxylate (CID 7782208) is [(1R)-1-cyanoethyl] 2-phenylquinoline-4-carboxylate.
What is the SMILES notation for [(1R)-1-cyanoethyl] 2-phenylquinoline-4-carboxylate?
The canonical SMILES for [(1R)-1-cyanoethyl] 2-phenylquinoline-4-carboxylate is C[C@H](C#N)OC(=O)c1cc(-c2ccccc2)nc2ccccc12.
What is the InChIKey of [(1R)-1-cyanoethyl] 2-phenylquinoline-4-carboxylate?
The InChIKey is WRXCPYDXJZBRHD-CYBMUJFWSA-N. The full InChI is InChI=1S/C19H14N2O2/c1-13(12-20)23-19(22)16-11-18(14-7-3-2-4-8-14)21-17-10-6-5-9-15(16)17/h2-11,13H,1H3/t13-/m1/s1.
What are the key properties of [(1R)-1-cyanoethyl] 2-phenylquinoline-4-carboxylate?
[(1R)-1-cyanoethyl] 2-phenylquinoline-4-carboxylate has a molecular weight of 302.33 g/mol, XLogP of 3.97, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-cyanoethyl] 2-phenylquinoline-4-carboxylate is sourced from PubChem (CID 7782208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).