C19H11Cl3N2O2 — CID 7825399
[(1R)-1-cyanoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate (PubChem CID 7825399) has the molecular formula C19H11Cl3N2O2 and a molecular weight of 405.67 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate.
| Compound Name | [(1R)-1-cyanoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 7825399 |
| Molecular Formula | C19H11Cl3N2O2 |
| Molecular Weight | 405.67 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | [(1R)-1-cyanoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate |
| SMILES | C[C@H](C#N)OC(=O)c1cc(-c2ccc(Cl)c(Cl)c2Cl)nc2ccccc12 |
| InChI | InChI=1S/C19H11Cl3N2O2/c1-10(9-23)26-19(25)13-8-16(24-15-5-3-2-4-11(13)15)12-6-7-14(20)18(22)17(12)21/h2-8,10H,1H3/t10-/m1/s1 |
| InChIKey | JGTNMYYIVMJJCA-SNVBAGLBSA-N |
| XLogP | 5.93 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.67 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|