C29H19Cl2NO2 — CID 126189481
benzhydryl 2-(3,4-dichlorophenyl)quinoline-4-carboxylate (PubChem CID 126189481) has the molecular formula C29H19Cl2NO2 and a molecular weight of 484.38 g/mol. Its IUPAC name is benzhydryl 2-(3,4-dichlorophenyl)quinoline-4-carboxylate.
| Compound Name | benzhydryl 2-(3,4-dichlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 126189481 |
| Molecular Formula | C29H19Cl2NO2 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | benzhydryl 2-(3,4-dichlorophenyl)quinoline-4-carboxylate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)c1cc(-c2ccc(Cl)c(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C29H19Cl2NO2/c30-24-16-15-21(17-25(24)31)27-18-23(22-13-7-8-14-26(22)32-27)29(33)34-28(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-18,28H |
| InChIKey | SPGAYJKOGNRPGC-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |